About 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione
4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (PubChem CID 134233929) has the molecular formula C34H18F6N2O2
and a molecular weight of 600.52 g/mol. Its IUPAC name is 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| PubChem CID | 134233929 |
| Molecular Formula | C34H18F6N2O2 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4c(C(F)(F)F)cccc4c4cccc(C(F)(F)F)c43)c2C(=O)N1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H18F6N2O2/c35-33(36,37)24-15-6-12-21-22-13-7-16-25(34(38,39)40)30(22)41(29(21)24)27-18-8-14-23-28(27)32(44)42(31(23)43)26-17-5-4-11-20(26)19-9-2-1-3-10-19/h1-18H |
| InChIKey | FHFFJNUVNSYZEZ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione?
The IUPAC name of 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (CID 134233929) is 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
What is the SMILES notation for 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione?
The canonical SMILES for 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione is O=C1c2cccc(-n3c4c(C(F)(F)F)cccc4c4cccc(C(F)(F)F)c43)c2C(=O)N1c1ccccc1-c1ccccc1.
What is the InChIKey of 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione?
The InChIKey is FHFFJNUVNSYZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H18F6N2O2/c35-33(36,37)24-15-6-12-21-22-13-7-16-25(34(38,39)40)30(22)41(29(21)24)27-18-8-14-23-28(27)32(44)42(31(23)43)26-17-5-4-11-20(26)19-9-2-1-3-10-19/h1-18H.
What are the key properties of 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione?
4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione has a molecular weight of 600.52 g/mol, XLogP of 9.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,8-bis(trifluoromethyl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione is sourced from PubChem (CID 134233929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).