About 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione
2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 134233946) has the molecular formula C39H23F3N2O2
and a molecular weight of 608.62 g/mol. Its IUPAC name is 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione |
| PubChem CID | 134233946 |
| Molecular Formula | C39H23F3N2O2 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccccc4c4ccc(C(F)(F)F)cc43)c2C(=O)N1c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C39H23F3N2O2/c40-39(41,42)26-21-22-30-29-15-7-8-19-32(29)43(34(30)23-26)33-20-10-18-31-35(33)38(46)44(37(31)45)36-27(24-11-3-1-4-12-24)16-9-17-28(36)25-13-5-2-6-14-25/h1-23H |
| InChIKey | IJWVOMZJIUCCSW-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione?
The IUPAC name of 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione (CID 134233946) is 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione.
What is the SMILES notation for 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione?
The canonical SMILES for 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione is O=C1c2cccc(-n3c4ccccc4c4ccc(C(F)(F)F)cc43)c2C(=O)N1c1c(-c2ccccc2)cccc1-c1ccccc1.
What is the InChIKey of 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione?
The InChIKey is IJWVOMZJIUCCSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H23F3N2O2/c40-39(41,42)26-21-22-30-29-15-7-8-19-32(29)43(34(30)23-26)33-20-10-18-31-35(33)38(46)44(37(31)45)36-27(24-11-3-1-4-12-24)16-9-17-28(36)25-13-5-2-6-14-25/h1-23H.
What are the key properties of 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione?
2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione has a molecular weight of 608.62 g/mol, XLogP of 9.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diphenylphenyl)-4-[2-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione is sourced from PubChem (CID 134233946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).