C46H26F6N2O2 — CID 134233997
4-[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134233997) has the molecular formula C46H26F6N2O2 and a molecular weight of 752.71 g/mol. Its IUPAC name is 4-[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134233997 |
| Molecular Formula | C46H26F6N2O2 |
| Molecular Weight | 752.71 g/mol |
| Exact Mass | 752.19 |
| IUPAC Name | 4-[2-[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c2C(=O)N1c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C46H26F6N2O2/c47-45(48,49)32-19-21-34(38(26-32)46(50,51)52)29-18-20-36-35-14-7-8-16-39(35)54(41(36)25-29)40-17-9-15-37-42(40)44(56)53(43(37)55)33-23-30(27-10-3-1-4-11-27)22-31(24-33)28-12-5-2-6-13-28/h1-26H |
| InChIKey | OUHMLSUSMMTMNV-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.71 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|