C54H28F12N2O2 — CID 134234315
4-[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134234315) has the molecular formula C54H28F12N2O2 and a molecular weight of 964.81 g/mol. Its IUPAC name is 4-[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234315 |
| Molecular Formula | C54H28F12N2O2 |
| Molecular Weight | 964.81 g/mol |
| Exact Mass | 964.20 |
| IUPAC Name | 4-[2,7-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)ccc4c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc43)c2C(=O)N1c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C54H28F12N2O2/c55-51(56,57)33-19-23-35(42(27-33)53(61,62)63)31-17-21-39-40-22-18-32(36-24-20-34(52(58,59)60)28-43(36)54(64,65)66)26-46(40)67(45(39)25-31)44-16-8-15-41-47(44)50(70)68(49(41)69)48-37(29-9-3-1-4-10-29)13-7-14-38(48)30-11-5-2-6-12-30/h1-28H |
| InChIKey | KHSJBKMELZDVMB-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.81 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|