C60H35F9N2O2 — CID 134234394
4-[2-[3,5-bis(trifluoromethyl)phenyl]-7-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione (PubChem CID 134234394) has the molecular formula C60H35F9N2O2 and a molecular weight of 986.93 g/mol. Its IUPAC name is 4-[2-[3,5-bis(trifluoromethyl)phenyl]-7-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2-[3,5-bis(trifluoromethyl)phenyl]-7-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234394 |
| Molecular Formula | C60H35F9N2O2 |
| Molecular Weight | 986.93 g/mol |
| Exact Mass | 986.26 |
| IUPAC Name | 4-[2-[3,5-bis(trifluoromethyl)phenyl]-7-[3-methyl-5-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cc(-c2ccc3c4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc4n(-c4cccc5c4C(=O)N(c4c(-c6ccccc6)cc(-c6ccccc6)cc4-c4ccccc4)C5=O)c3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C60H35F9N2O2/c1-34-24-40(26-43(25-34)58(61,62)63)38-20-22-46-47-23-21-39(41-27-44(59(64,65)66)33-45(28-41)60(67,68)69)32-53(47)70(52(46)31-38)51-19-11-18-48-54(51)57(73)71(56(48)72)55-49(36-14-7-3-8-15-36)29-42(35-12-5-2-6-13-35)30-50(55)37-16-9-4-10-17-37/h2-33H,1H3 |
| InChIKey | KWEMPCGQWKFDPU-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.93 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|