About 2-benzoyl-3-methyl-1,2-oxazol-5-one
2-benzoyl-3-methyl-1,2-oxazol-5-one (PubChem CID 13423446) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-benzoyl-3-methyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 2-benzoyl-3-methyl-1,2-oxazol-5-one |
| PubChem CID | 13423446 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-benzoyl-3-methyl-1,2-oxazol-5-one |
| SMILES | Cc1cc(=O)on1C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO3/c1-8-7-10(13)15-12(8)11(14)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | ASEHYFRRVOVDDE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzoyl-3-methyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyl-3-methyl-1,2-oxazol-5-one?
The IUPAC name of 2-benzoyl-3-methyl-1,2-oxazol-5-one (CID 13423446) is 2-benzoyl-3-methyl-1,2-oxazol-5-one.
What is the SMILES notation for 2-benzoyl-3-methyl-1,2-oxazol-5-one?
The canonical SMILES for 2-benzoyl-3-methyl-1,2-oxazol-5-one is Cc1cc(=O)on1C(=O)c1ccccc1.
What is the InChIKey of 2-benzoyl-3-methyl-1,2-oxazol-5-one?
The InChIKey is ASEHYFRRVOVDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-8-7-10(13)15-12(8)11(14)9-5-3-2-4-6-9/h2-7H,1H3.
What are the key properties of 2-benzoyl-3-methyl-1,2-oxazol-5-one?
2-benzoyl-3-methyl-1,2-oxazol-5-one has a molecular weight of 203.20 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-3-methyl-1,2-oxazol-5-one is sourced from PubChem (CID 13423446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).