C57H36N6O2 — CID 134234895
2-[1,8-bis(6-cyano-2-pyridinyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-triphenylphenyl)benzamide (PubChem CID 134234895) has the molecular formula C57H36N6O2 and a molecular weight of 836.96 g/mol. Its IUPAC name is 2-[1,8-bis(6-cyano-2-pyridinyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-triphenylphenyl)benzamide.
| Compound Name | 2-[1,8-bis(6-cyano-2-pyridinyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-triphenylphenyl)benzamide |
|---|---|
| PubChem CID | 134234895 |
| Molecular Formula | C57H36N6O2 |
| Molecular Weight | 836.96 g/mol |
| Exact Mass | 836.29 |
| IUPAC Name | 2-[1,8-bis(6-cyano-2-pyridinyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-triphenylphenyl)benzamide |
| SMILES | Cc1cccc(-n2c3c(-c4cccc(C#N)n4)cccc3c3cccc(-c4cccc(C#N)n4)c32)c1C(=O)N(C=O)c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C57H36N6O2/c1-37-16-11-31-52(63-55-44(25-14-27-46(55)50-29-12-23-42(34-58)60-50)45-26-15-28-47(56(45)63)51-30-13-24-43(35-59)61-51)53(37)57(65)62(36-64)54-48(39-19-7-3-8-20-39)32-41(38-17-5-2-6-18-38)33-49(54)40-21-9-4-10-22-40/h2-33,36H,1H3 |
| InChIKey | SACQFVAUOCAQFW-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 115.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.96 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|