C25H19F3O5S — CID 134235510
(7',9',9'-trimethyl-3-oxospiro[2-benzofuran-1,10'-anthracene]-2'-yl) trifluoromethanesulfonate (PubChem CID 134235510) has the molecular formula C25H19F3O5S and a molecular weight of 488.48 g/mol. Its IUPAC name is (7',9',9'-trimethyl-3-oxospiro[2-benzofuran-1,10'-anthracene]-2'-yl) trifluoromethanesulfonate.
| Compound Name | (7',9',9'-trimethyl-3-oxospiro[2-benzofuran-1,10'-anthracene]-2'-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134235510 |
| Molecular Formula | C25H19F3O5S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (7',9',9'-trimethyl-3-oxospiro[2-benzofuran-1,10'-anthracene]-2'-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H19F3O5S/c1-14-8-10-18-20(12-14)23(2,3)21-13-15(33-34(30,31)25(26,27)28)9-11-19(21)24(18)17-7-5-4-6-16(17)22(29)32-24/h4-13H,1-3H3 |
| InChIKey | ORRGBOPHYVDXIN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|