C19H34O3 — CID 134235847
(2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanoate (PubChem CID 134235847) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanoate.
| Compound Name | (2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanoate |
|---|---|
| PubChem CID | 134235847 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2,3,3,6-tetramethyl-5-oxohept-6-en-2-yl) 2,2,3,3-tetramethylbutanoate |
| SMILES | C=C(C)C(=O)CC(C)(C)C(C)(C)OC(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3/c1-13(2)14(20)12-17(6,7)19(10,11)22-15(21)18(8,9)16(3,4)5/h1,12H2,2-11H3 |
| InChIKey | BEIVQVCDWUMILK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|