About [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene
[4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene (PubChem CID 134235868) has the molecular formula C22H18F3N5O
and a molecular weight of 425.41 g/mol. Its IUPAC name is [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene.
Molecular Properties
| Compound Name | [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene |
| PubChem CID | 134235868 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene |
| SMILES | FC(F)(F)c1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCOC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18F3N5O/c23-22(24,25)16-1-3-17(4-2-16)26-27-18-5-7-19(8-6-18)28-29-20-9-11-21(12-10-20)30-13-14-31-15-30/h1-12H,13-15H2/b27-26+,29-28+ |
| InChIKey | DRFGYSQJJBTPEW-ZDXBJJIESA-N |
| XLogP | 7.33 |
| TPSA | 61.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene?
The IUPAC name of [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene (CID 134235868) is [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene.
What is the SMILES notation for [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene?
The canonical SMILES for [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene is FC(F)(F)c1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCOC4)cc3)cc2)cc1.
What is the InChIKey of [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene?
The InChIKey is DRFGYSQJJBTPEW-ZDXBJJIESA-N. The full InChI is InChI=1S/C22H18F3N5O/c23-22(24,25)16-1-3-17(4-2-16)26-27-18-5-7-19(8-6-18)28-29-20-9-11-21(12-10-20)30-13-14-31-15-30/h1-12H,13-15H2/b27-26+,29-28+.
What are the key properties of [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene?
[4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene has a molecular weight of 425.41 g/mol, XLogP of 7.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-oxazolidin-3-yl)phenyl]-[4-[[4-(trifluoromethyl)phenyl]diazenyl]phenyl]diazene is sourced from PubChem (CID 134235868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).