C5H3F3N2S — CID 13423705
2,4,6-trifluoro-5-methylsulfanylpyrimidine (PubChem CID 13423705) has the molecular formula C5H3F3N2S and a molecular weight of 180.15 g/mol. Its IUPAC name is 2,4,6-trifluoro-5-methylsulfanylpyrimidine.
| Compound Name | 2,4,6-trifluoro-5-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 13423705 |
| Molecular Formula | C5H3F3N2S |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 2,4,6-trifluoro-5-methylsulfanylpyrimidine |
| SMILES | CSc1c(F)nc(F)nc1F |
| InChI | InChI=1S/C5H3F3N2S/c1-11-2-3(6)9-5(8)10-4(2)7/h1H3 |
| InChIKey | KPDNMMOXFDOPHP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |