About 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine
10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine (PubChem CID 134237292) has the molecular formula C26H22N2O2S
and a molecular weight of 426.54 g/mol. Its IUPAC name is 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine.
Molecular Properties
| Compound Name | 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine |
| PubChem CID | 134237292 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccc(S(=O)(=O)c3ccccc3)cn2)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O2S/c1-26(2)21-12-6-8-14-23(21)28(24-15-9-7-13-22(24)26)25-17-16-20(18-27-25)31(29,30)19-10-4-3-5-11-19/h3-18H,1-2H3 |
| InChIKey | OYIMHDLMQGVXKY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine?
The IUPAC name of 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine (CID 134237292) is 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine.
What is the SMILES notation for 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine?
The canonical SMILES for 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine is CC1(C)c2ccccc2N(c2ccc(S(=O)(=O)c3ccccc3)cn2)c2ccccc21.
What is the InChIKey of 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine?
The InChIKey is OYIMHDLMQGVXKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O2S/c1-26(2)21-12-6-8-14-23(21)28(24-15-9-7-13-22(24)26)25-17-16-20(18-27-25)31(29,30)19-10-4-3-5-11-19/h3-18H,1-2H3.
What are the key properties of 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine?
10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine has a molecular weight of 426.54 g/mol, XLogP of 6.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[5-(benzenesulfonyl)-2-pyridinyl]-9,9-dimethylacridine is sourced from PubChem (CID 134237292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).