C39H31N3O3S — CID 134237340
10-[9,9-dimethyl-10-(2-methyl-4-pyridin-2-ylsulfonylphenyl)acridin-2-yl]phenoxazine (PubChem CID 134237340) has the molecular formula C39H31N3O3S and a molecular weight of 621.76 g/mol. Its IUPAC name is 10-[9,9-dimethyl-10-(2-methyl-4-pyridin-2-ylsulfonylphenyl)acridin-2-yl]phenoxazine.
| Compound Name | 10-[9,9-dimethyl-10-(2-methyl-4-pyridin-2-ylsulfonylphenyl)acridin-2-yl]phenoxazine |
|---|---|
| PubChem CID | 134237340 |
| Molecular Formula | C39H31N3O3S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 10-[9,9-dimethyl-10-(2-methyl-4-pyridin-2-ylsulfonylphenyl)acridin-2-yl]phenoxazine |
| SMILES | Cc1cc(S(=O)(=O)c2ccccn2)ccc1N1c2ccccc2C(C)(C)c2cc(N3c4ccccc4Oc4ccccc43)ccc21 |
| InChI | InChI=1S/C39H31N3O3S/c1-26-24-28(46(43,44)38-18-10-11-23-40-38)20-22-31(26)42-32-13-5-4-12-29(32)39(2,3)30-25-27(19-21-33(30)42)41-34-14-6-8-16-36(34)45-37-17-9-7-15-35(37)41/h4-25H,1-3H3 |
| InChIKey | XYSTUOJTUUXDMO-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |