C19H18F3I3O7S — CID 134237574
3,3,3-trifluoro-2-[3-(2,4,6-triiodophenoxy)carbonylbicyclo[2.2.2]octane-2-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 134237574) has the molecular formula C19H18F3I3O7S and a molecular weight of 828.12 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[3-(2,4,6-triiodophenoxy)carbonylbicyclo[2.2.2]octane-2-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[3-(2,4,6-triiodophenoxy)carbonylbicyclo[2.2.2]octane-2-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 134237574 |
| Molecular Formula | C19H18F3I3O7S |
| Molecular Weight | 828.12 g/mol |
| Exact Mass | 827.79 |
| IUPAC Name | 3,3,3-trifluoro-2-[3-(2,4,6-triiodophenoxy)carbonylbicyclo[2.2.2]octane-2-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)C1C2CCC(CC2)C1C(=O)OC(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C19H18F3I3O7S/c20-19(21,22)13(7-33(28,29)30)31-17(26)14-8-1-3-9(4-2-8)15(14)18(27)32-16-11(24)5-10(23)6-12(16)25/h5-6,8-9,13-15H,1-4,7H2,(H,28,29,30) |
| InChIKey | SYHJLBRBCLRCSQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.12 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|