C30H11F2I9O11S — CID 134237623
1,1-difluoro-2-[2,4,5-tris[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxyethanesulfonic acid (PubChem CID 134237623) has the molecular formula C30H11F2I9O11S and a molecular weight of 1759.61 g/mol. Its IUPAC name is 1,1-difluoro-2-[2,4,5-tris[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2,4,5-tris[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 134237623 |
| Molecular Formula | C30H11F2I9O11S |
| Molecular Weight | 1759.61 g/mol |
| Exact Mass | 1759.14 |
| IUPAC Name | 1,1-difluoro-2-[2,4,5-tris[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1cc(C(=O)Oc2c(I)cc(I)cc2I)c(C(=O)Oc2c(I)cc(I)cc2I)cc1C(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C30H11F2I9O11S/c31-30(32,53(46,47)48)9-49-26(42)13-7-15(28(44)51-24-19(38)3-11(34)4-20(24)39)16(29(45)52-25-21(40)5-12(35)6-22(25)41)8-14(13)27(43)50-23-17(36)1-10(33)2-18(23)37/h1-8H,9H2,(H,46,47,48) |
| InChIKey | RDXGFPSGDVPYBX-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1759.61 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|