C14H4F18O2 — CID 134238175
1,3,3,4,4,5,5-heptafluoro-2-[2,2,3,3-tetrafluoro-4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybutoxy]cyclopentene (PubChem CID 134238175) has the molecular formula C14H4F18O2 and a molecular weight of 546.15 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[2,2,3,3-tetrafluoro-4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybutoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[2,2,3,3-tetrafluoro-4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybutoxy]cyclopentene |
|---|---|
| PubChem CID | 134238175 |
| Molecular Formula | C14H4F18O2 |
| Molecular Weight | 546.15 g/mol |
| Exact Mass | 545.99 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[2,2,3,3-tetrafluoro-4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybutoxy]cyclopentene |
| SMILES | FC1=C(OCC(F)(F)C(F)(F)COC2=C(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H4F18O2/c15-3-5(11(25,26)13(29,30)9(3,21)22)33-1-7(17,18)8(19,20)2-34-6-4(16)10(23,24)14(31,32)12(6,27)28/h1-2H2 |
| InChIKey | MRFSVRZNFMDEQL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.15 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|