C14H4F14O2 — CID 134238176
1,3,3,4,4,5,5-heptafluoro-2-[4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybut-2-ynoxy]cyclopentene (PubChem CID 134238176) has the molecular formula C14H4F14O2 and a molecular weight of 470.16 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybut-2-ynoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybut-2-ynoxy]cyclopentene |
|---|---|
| PubChem CID | 134238176 |
| Molecular Formula | C14H4F14O2 |
| Molecular Weight | 470.16 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[4-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxybut-2-ynoxy]cyclopentene |
| SMILES | FC1=C(OCC#CCOC2=C(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H4F14O2/c15-5-7(11(21,22)13(25,26)9(5,17)18)29-3-1-2-4-30-8-6(16)10(19,20)14(27,28)12(8,23)24/h3-4H2 |
| InChIKey | NIBZCSPTMFZBRD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|