About 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine
3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine (PubChem CID 134238320) has the molecular formula C26H31NO2S
and a molecular weight of 421.61 g/mol. Its IUPAC name is 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine.
Molecular Properties
| Compound Name | 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine |
| PubChem CID | 134238320 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine |
| SMILES | CC(C)(C)c1ccc(O)c(O)c1C(C)(C)C.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C14H22O2.C12H9NS/c1-13(2,3)9-7-8-10(15)12(16)11(9)14(4,5)6;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h7-8,15-16H,1-6H3;1-8,13H |
| InChIKey | NTBJNMRUBSDZJY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine?
The IUPAC name of 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine (CID 134238320) is 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine.
What is the SMILES notation for 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine?
The canonical SMILES for 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine is CC(C)(C)c1ccc(O)c(O)c1C(C)(C)C.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine?
The InChIKey is NTBJNMRUBSDZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2.C12H9NS/c1-13(2,3)9-7-8-10(15)12(16)11(9)14(4,5)6;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h7-8,15-16H,1-6H3;1-8,13H.
What are the key properties of 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine?
3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine has a molecular weight of 421.61 g/mol, XLogP of 7.59, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butylbenzene-1,2-diol;10H-phenothiazine is sourced from PubChem (CID 134238320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).