C35H51N9O — CID 134238351
20,24-dimethyl-15-(2-piperazin-1-ylethoxymethyl)-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene (PubChem CID 134238351) has the molecular formula C35H51N9O and a molecular weight of 613.86 g/mol. Its IUPAC name is 20,24-dimethyl-15-(2-piperazin-1-ylethoxymethyl)-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene.
| Compound Name | 20,24-dimethyl-15-(2-piperazin-1-ylethoxymethyl)-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene |
|---|---|
| PubChem CID | 134238351 |
| Molecular Formula | C35H51N9O |
| Molecular Weight | 613.86 g/mol |
| Exact Mass | 613.42 |
| IUPAC Name | 20,24-dimethyl-15-(2-piperazin-1-ylethoxymethyl)-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene |
| SMILES | CC1CCCN(C)c2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)CN2CCN(CC1)CC2COCCN1CCNCC1 |
| InChI | InChI=1S/C35H51N9O/c1-28-5-4-15-41(2)34-9-8-30(24-38-34)33-10-12-37-35(40-33)39-31-7-3-6-29(23-31)25-44-20-19-43(16-11-28)26-32(44)27-45-22-21-42-17-13-36-14-18-42/h3,6-10,12,23-24,28,32,36H,4-5,11,13-22,25-27H2,1-2H3,(H,37,39,40) |
| InChIKey | XTGCXUURDHQYDE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|