C28H36N8 — CID 134238353
5,7,14,17,20,27,29,36-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaene (PubChem CID 134238353) has the molecular formula C28H36N8 and a molecular weight of 484.65 g/mol. Its IUPAC name is 5,7,14,17,20,27,29,36-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaene.
| Compound Name | 5,7,14,17,20,27,29,36-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaene |
|---|---|
| PubChem CID | 134238353 |
| Molecular Formula | C28H36N8 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 5,7,14,17,20,27,29,36-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaene |
| SMILES | c1cc2cc(c1)Nc1nccc(n1)-c1ccc(nc1)N1CCCC1CCNCCN1CCN(CC1)C2 |
| InChI | InChI=1S/C28H36N8/c1-3-22-19-24(4-1)32-28-30-11-9-26(33-28)23-6-7-27(31-20-23)36-13-2-5-25(36)8-10-29-12-14-34-15-17-35(21-22)18-16-34/h1,3-4,6-7,9,11,19-20,25,29H,2,5,8,10,12-18,21H2,(H,30,32,33) |
| InChIKey | WUIFDZSNMCTVQY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |