About 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran
7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran (PubChem CID 134238646) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran.
Analyze 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran?
The IUPAC name of 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran (CID 134238646) is 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran.
What is the SMILES notation for 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran?
The canonical SMILES for 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran is CC1=C2CCOC2C(F)C=C1.
What is the InChIKey of 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran?
The InChIKey is MIUVVFDWTBCHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c1-6-2-3-8(10)9-7(6)4-5-11-9/h2-3,8-9H,4-5H2,1H3.
What are the key properties of 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran?
7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran has a molecular weight of 154.18 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methyl-2,3,7,7a-tetrahydro-1-benzofuran is sourced from PubChem (CID 134238646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).