C22H29NO2 — CID 134238679
N-[(3Z,4E,6E,8E)-8-ethenyl-3-ethylidene-5-oxo-4-prop-2-enylidenetrideca-6,8,12-trienyl]acetamide (PubChem CID 134238679) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(3Z,4E,6E,8E)-8-ethenyl-3-ethylidene-5-oxo-4-prop-2-enylidenetrideca-6,8,12-trienyl]acetamide.
| Compound Name | N-[(3Z,4E,6E,8E)-8-ethenyl-3-ethylidene-5-oxo-4-prop-2-enylidenetrideca-6,8,12-trienyl]acetamide |
|---|---|
| PubChem CID | 134238679 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-[(3Z,4E,6E,8E)-8-ethenyl-3-ethylidene-5-oxo-4-prop-2-enylidenetrideca-6,8,12-trienyl]acetamide |
| SMILES | C=C/C=C(C(=O)/C=C/C(C=C)=C/CCC=C)\C(=C/C)CCNC(C)=O |
| InChI | InChI=1S/C22H29NO2/c1-6-10-11-13-19(8-3)14-15-22(25)21(12-7-2)20(9-4)16-17-23-18(5)24/h6-9,12-15H,1-3,10-11,16-17H2,4-5H3,(H,23,24)/b15-14+,19-13+,20-9-,21-12+ |
| InChIKey | GWQHLCKSPOLTOX-XWWNOTNUSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|