C11H15N — CID 134238863
(1Z,4Z,6Z)-8-methylidenedeca-1,4,6,9-tetraen-1-amine (PubChem CID 134238863) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (1Z,4Z,6Z)-8-methylidenedeca-1,4,6,9-tetraen-1-amine.
| Compound Name | (1Z,4Z,6Z)-8-methylidenedeca-1,4,6,9-tetraen-1-amine |
|---|---|
| PubChem CID | 134238863 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1Z,4Z,6Z)-8-methylidenedeca-1,4,6,9-tetraen-1-amine |
| SMILES | C=CC(=C)/C=C\C=C/C/C=C\N |
| InChI | InChI=1S/C11H15N/c1-3-11(2)9-7-5-4-6-8-10-12/h3-5,7-10H,1-2,6,12H2/b5-4-,9-7-,10-8- |
| InChIKey | OHECECULBGGHEC-KAMLYLFASA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|