C10H16F3N3 — CID 134239276
(2E,4E,6E)-4-[amino(methyl)amino]-6-(trifluoromethyl)octa-2,4,6-trien-3-amine (PubChem CID 134239276) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is (2E,4E,6E)-4-[amino(methyl)amino]-6-(trifluoromethyl)octa-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-4-[amino(methyl)amino]-6-(trifluoromethyl)octa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 134239276 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2E,4E,6E)-4-[amino(methyl)amino]-6-(trifluoromethyl)octa-2,4,6-trien-3-amine |
| SMILES | C/C=C(N)\C(=C/C(=C\C)C(F)(F)F)N(C)N |
| InChI | InChI=1S/C10H16F3N3/c1-4-7(10(11,12)13)6-9(16(3)15)8(14)5-2/h4-6H,14-15H2,1-3H3/b7-4+,8-5+,9-6+ |
| InChIKey | KVHAHZSZUHGYJO-OTWDQPKHSA-N |
| XLogP | 2.05 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|