About 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine
6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 134239293) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 134239293 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | [H]/N=N/C1CC(OC)=CC=C1NCOC |
| InChI | InChI=1S/C9H15N3O2/c1-13-6-11-8-4-3-7(14-2)5-9(8)12-10/h3-4,9-11H,5-6H2,1-2H3/b12-10+ |
| InChIKey | YVQRZBNLCUYMCR-ZRDIBKRKSA-N |
| XLogP | 1.40 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine (CID 134239293) is 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine is [H]/N=N/C1CC(OC)=CC=C1NCOC.
What is the InChIKey of 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is YVQRZBNLCUYMCR-ZRDIBKRKSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-13-6-11-8-4-3-7(14-2)5-9(8)12-10/h3-4,9-11H,5-6H2,1-2H3/b12-10+.
What are the key properties of 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine?
6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 197.24 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazenyl-4-methoxy-N-(methoxymethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 134239293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).