About (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole
(3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole (PubChem CID 134239299) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole.
Molecular Properties
| Compound Name | (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole |
| PubChem CID | 134239299 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole |
| SMILES | CC(C)(C)N1C=NC2=CC(F)=CC[C@@H]21 |
| InChI | InChI=1S/C11H15FN2/c1-11(2,3)14-7-13-9-6-8(12)4-5-10(9)14/h4,6-7,10H,5H2,1-3H3/t10-/m0/s1 |
| InChIKey | UHLJIHAHYPJGML-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole?
The IUPAC name of (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole (CID 134239299) is (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole.
What is the SMILES notation for (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole?
The canonical SMILES for (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole is CC(C)(C)N1C=NC2=CC(F)=CC[C@@H]21.
What is the InChIKey of (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole?
The InChIKey is UHLJIHAHYPJGML-JTQLQIEISA-N. The full InChI is InChI=1S/C11H15FN2/c1-11(2,3)14-7-13-9-6-8(12)4-5-10(9)14/h4,6-7,10H,5H2,1-3H3/t10-/m0/s1.
What are the key properties of (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole?
(3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole has a molecular weight of 194.25 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-3-tert-butyl-6-fluoro-3a,4-dihydrobenzimidazole is sourced from PubChem (CID 134239299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).