About 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole
1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole (PubChem CID 134239381) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole |
| PubChem CID | 134239381 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole |
| SMILES | C#C/C=C\C(=C/C)CN1C=NC2CC=CC=C21 |
| InChI | InChI=1S/C15H16N2/c1-3-5-8-13(4-2)11-17-12-16-14-9-6-7-10-15(14)17/h1,4-8,10,12,14H,9,11H2,2H3/b8-5-,13-4+ |
| InChIKey | MOUXNVMPPROFMI-RPMRFSCESA-N |
| XLogP | 2.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole?
The IUPAC name of 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole (CID 134239381) is 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole.
What is the SMILES notation for 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole?
The canonical SMILES for 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole is C#C/C=C\C(=C/C)CN1C=NC2CC=CC=C21.
What is the InChIKey of 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole?
The InChIKey is MOUXNVMPPROFMI-RPMRFSCESA-N. The full InChI is InChI=1S/C15H16N2/c1-3-5-8-13(4-2)11-17-12-16-14-9-6-7-10-15(14)17/h1,4-8,10,12,14H,9,11H2,2H3/b8-5-,13-4+.
What are the key properties of 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole?
1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole has a molecular weight of 224.31 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,2E)-2-ethylidenehex-3-en-5-ynyl]-3a,4-dihydrobenzimidazole is sourced from PubChem (CID 134239381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).