About 1-butyl-5-methyl-3a,4-dihydrobenzimidazole
1-butyl-5-methyl-3a,4-dihydrobenzimidazole (PubChem CID 134239411) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-butyl-5-methyl-3a,4-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-butyl-5-methyl-3a,4-dihydrobenzimidazole |
| PubChem CID | 134239411 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-butyl-5-methyl-3a,4-dihydrobenzimidazole |
| SMILES | CCCCN1C=NC2CC(C)=CC=C21 |
| InChI | InChI=1S/C12H18N2/c1-3-4-7-14-9-13-11-8-10(2)5-6-12(11)14/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | SRUVLTPSEIBYHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-5-methyl-3a,4-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-methyl-3a,4-dihydrobenzimidazole?
The IUPAC name of 1-butyl-5-methyl-3a,4-dihydrobenzimidazole (CID 134239411) is 1-butyl-5-methyl-3a,4-dihydrobenzimidazole.
What is the SMILES notation for 1-butyl-5-methyl-3a,4-dihydrobenzimidazole?
The canonical SMILES for 1-butyl-5-methyl-3a,4-dihydrobenzimidazole is CCCCN1C=NC2CC(C)=CC=C21.
What is the InChIKey of 1-butyl-5-methyl-3a,4-dihydrobenzimidazole?
The InChIKey is SRUVLTPSEIBYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-3-4-7-14-9-13-11-8-10(2)5-6-12(11)14/h5-6,9,11H,3-4,7-8H2,1-2H3.
What are the key properties of 1-butyl-5-methyl-3a,4-dihydrobenzimidazole?
1-butyl-5-methyl-3a,4-dihydrobenzimidazole has a molecular weight of 190.29 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-methyl-3a,4-dihydrobenzimidazole is sourced from PubChem (CID 134239411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).