C11H20N2 — CID 134239482
(2E,4E)-6-methyl-3-N-propan-2-ylhepta-2,4,6-triene-3,4-diamine (PubChem CID 134239482) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E,4E)-6-methyl-3-N-propan-2-ylhepta-2,4,6-triene-3,4-diamine.
| Compound Name | (2E,4E)-6-methyl-3-N-propan-2-ylhepta-2,4,6-triene-3,4-diamine |
|---|---|
| PubChem CID | 134239482 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2E,4E)-6-methyl-3-N-propan-2-ylhepta-2,4,6-triene-3,4-diamine |
| SMILES | C=C(C)/C=C(N)\C(=C/C)NC(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-11(13-9(4)5)10(12)7-8(2)3/h6-7,9,13H,2,12H2,1,3-5H3/b10-7+,11-6- |
| InChIKey | WMSSEQNTWZJGKS-SJUGDSPGSA-N |
| XLogP | 2.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|