About 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole
1-butyl-5-methoxy-3a,4-dihydrobenzotriazole (PubChem CID 134239493) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole |
| PubChem CID | 134239493 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole |
| SMILES | CCCCN1N=NC2CC(OC)=CC=C21 |
| InChI | InChI=1S/C11H17N3O/c1-3-4-7-14-11-6-5-9(15-2)8-10(11)12-13-14/h5-6,10H,3-4,7-8H2,1-2H3 |
| InChIKey | IKJOGNHHGKXLEV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole?
The IUPAC name of 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole (CID 134239493) is 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole.
What is the SMILES notation for 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole?
The canonical SMILES for 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole is CCCCN1N=NC2CC(OC)=CC=C21.
What is the InChIKey of 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole?
The InChIKey is IKJOGNHHGKXLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-3-4-7-14-11-6-5-9(15-2)8-10(11)12-13-14/h5-6,10H,3-4,7-8H2,1-2H3.
What are the key properties of 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole?
1-butyl-5-methoxy-3a,4-dihydrobenzotriazole has a molecular weight of 207.28 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-methoxy-3a,4-dihydrobenzotriazole is sourced from PubChem (CID 134239493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).