About 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole
7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole (PubChem CID 134239562) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole |
| PubChem CID | 134239562 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole |
| SMILES | CC1=C2N=NN(C(C)C)C2CC=C1 |
| InChI | InChI=1S/C10H15N3/c1-7(2)13-9-6-4-5-8(3)10(9)11-12-13/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | YBJKNPOUOAICPP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole?
The IUPAC name of 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole (CID 134239562) is 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole.
What is the SMILES notation for 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole?
The canonical SMILES for 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole is CC1=C2N=NN(C(C)C)C2CC=C1.
What is the InChIKey of 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole?
The InChIKey is YBJKNPOUOAICPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-7(2)13-9-6-4-5-8(3)10(9)11-12-13/h4-5,7,9H,6H2,1-3H3.
What are the key properties of 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole?
7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole has a molecular weight of 177.25 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-propan-2-yl-3a,4-dihydrobenzotriazole is sourced from PubChem (CID 134239562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).