About 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole
5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole (PubChem CID 134239613) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole |
| PubChem CID | 134239613 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole |
| SMILES | C=CCN1N=NC2=CC=C(C)CC21 |
| InChI | InChI=1S/C10H13N3/c1-3-6-13-10-7-8(2)4-5-9(10)11-12-13/h3-5,10H,1,6-7H2,2H3 |
| InChIKey | NCXOHWMCYNDFKY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole?
The IUPAC name of 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole (CID 134239613) is 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole.
What is the SMILES notation for 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole?
The canonical SMILES for 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole is C=CCN1N=NC2=CC=C(C)CC21.
What is the InChIKey of 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole?
The InChIKey is NCXOHWMCYNDFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-3-6-13-10-7-8(2)4-5-9(10)11-12-13/h3-5,10H,1,6-7H2,2H3.
What are the key properties of 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole?
5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole has a molecular weight of 175.23 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-prop-2-enyl-3a,4-dihydrobenzotriazole is sourced from PubChem (CID 134239613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).