About 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine
3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine (PubChem CID 134239724) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine.
Molecular Properties
| Compound Name | 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine |
| PubChem CID | 134239724 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine |
| SMILES | C=CCN1C=NC2CC(N)=CC=C2C1 |
| InChI | InChI=1S/C11H15N3/c1-2-5-14-7-9-3-4-10(12)6-11(9)13-8-14/h2-4,8,11H,1,5-7,12H2 |
| InChIKey | OIWIJVGDDXOXPI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine?
The IUPAC name of 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine (CID 134239724) is 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine.
What is the SMILES notation for 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine?
The canonical SMILES for 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine is C=CCN1C=NC2CC(N)=CC=C2C1.
What is the InChIKey of 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine?
The InChIKey is OIWIJVGDDXOXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-2-5-14-7-9-3-4-10(12)6-11(9)13-8-14/h2-4,8,11H,1,5-7,12H2.
What are the key properties of 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine?
3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine has a molecular weight of 189.26 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyl-8,8a-dihydro-4H-quinazolin-7-amine is sourced from PubChem (CID 134239724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).