C12H20N2O — CID 134239756
(3E,5E)-6-methoxy-3-N-methyl-2-N-prop-2-ynylhepta-3,5-diene-2,3-diamine (PubChem CID 134239756) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (3E,5E)-6-methoxy-3-N-methyl-2-N-prop-2-ynylhepta-3,5-diene-2,3-diamine.
| Compound Name | (3E,5E)-6-methoxy-3-N-methyl-2-N-prop-2-ynylhepta-3,5-diene-2,3-diamine |
|---|---|
| PubChem CID | 134239756 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (3E,5E)-6-methoxy-3-N-methyl-2-N-prop-2-ynylhepta-3,5-diene-2,3-diamine |
| SMILES | C#CCNC(C)/C(=C\C=C(/C)OC)NC |
| InChI | InChI=1S/C12H20N2O/c1-6-9-14-11(3)12(13-4)8-7-10(2)15-5/h1,7-8,11,13-14H,9H2,2-5H3/b10-7+,12-8+ |
| InChIKey | BHTDTXNAUPQOPX-SMTGYRLFSA-N |
| XLogP | 1.25 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|