C34H44FNO3 — CID 134240031
(E,8Z,10R)-5-[[4-[3-(cyclopropylmethoxy)phenoxy]-2-fluoro-6-methylphenyl]methoxy]-8-ethylidene-9,10-dimethyldodec-6-en-3-yn-6-amine (PubChem CID 134240031) has the molecular formula C34H44FNO3 and a molecular weight of 533.73 g/mol. Its IUPAC name is (E,8Z,10R)-5-[[4-[3-(cyclopropylmethoxy)phenoxy]-2-fluoro-6-methylphenyl]methoxy]-8-ethylidene-9,10-dimethyldodec-6-en-3-yn-6-amine.
| Compound Name | (E,8Z,10R)-5-[[4-[3-(cyclopropylmethoxy)phenoxy]-2-fluoro-6-methylphenyl]methoxy]-8-ethylidene-9,10-dimethyldodec-6-en-3-yn-6-amine |
|---|---|
| PubChem CID | 134240031 |
| Molecular Formula | C34H44FNO3 |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | (E,8Z,10R)-5-[[4-[3-(cyclopropylmethoxy)phenoxy]-2-fluoro-6-methylphenyl]methoxy]-8-ethylidene-9,10-dimethyldodec-6-en-3-yn-6-amine |
| SMILES | C/C=C(\C=C(\N)C(C#CCC)OCc1c(C)cc(Oc2cccc(OCC3CC3)c2)cc1F)C(C)[C@H](C)CC |
| InChI | InChI=1S/C34H44FNO3/c1-7-10-14-34(33(36)18-27(9-3)25(6)23(4)8-2)38-22-31-24(5)17-30(20-32(31)35)39-29-13-11-12-28(19-29)37-21-26-15-16-26/h9,11-13,17-20,23,25-26,34H,7-8,15-16,21-22,36H2,1-6H3/b27-9+,33-18+/t23-,25?,34?/m1/s1 |
| InChIKey | JQVGYTSGMBWQMC-REVBCMQFSA-N |
| XLogP | 8.48 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|