C43H33FN2O — CID 134240267
9-[(2E,4E)-4-dibenzofuran-4-yl-6-[2-[(Z)-3-fluoroprop-1-enyl]-3-methylindol-1-yl]hepta-2,4,6-trien-2-yl]carbazole (PubChem CID 134240267) has the molecular formula C43H33FN2O and a molecular weight of 612.75 g/mol. Its IUPAC name is 9-[(2E,4E)-4-dibenzofuran-4-yl-6-[2-[(Z)-3-fluoroprop-1-enyl]-3-methylindol-1-yl]hepta-2,4,6-trien-2-yl]carbazole.
| Compound Name | 9-[(2E,4E)-4-dibenzofuran-4-yl-6-[2-[(Z)-3-fluoroprop-1-enyl]-3-methylindol-1-yl]hepta-2,4,6-trien-2-yl]carbazole |
|---|---|
| PubChem CID | 134240267 |
| Molecular Formula | C43H33FN2O |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 9-[(2E,4E)-4-dibenzofuran-4-yl-6-[2-[(Z)-3-fluoroprop-1-enyl]-3-methylindol-1-yl]hepta-2,4,6-trien-2-yl]carbazole |
| SMILES | C=C(/C=C(\C=C(/C)n1c2ccccc2c2ccccc21)c1cccc2c1oc1ccccc12)n1c(/C=C\CF)c(C)c2ccccc21 |
| InChI | InChI=1S/C43H33FN2O/c1-28(45-38(23-13-25-44)30(3)32-14-4-8-20-39(32)45)26-31(33-18-12-19-37-36-17-7-11-24-42(36)47-43(33)37)27-29(2)46-40-21-9-5-15-34(40)35-16-6-10-22-41(35)46/h4-24,26-27H,1,25H2,2-3H3/b23-13-,29-27+,31-26+ |
| InChIKey | PXRVRTOXWYEGFA-XXNDJYBZSA-N |
| XLogP | 12.06 |
| TPSA | 23.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|