C37H20F12N2O — CID 134241711
7-[1,8-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-methyl-3H-isoindol-1-one (PubChem CID 134241711) has the molecular formula C37H20F12N2O and a molecular weight of 736.56 g/mol. Its IUPAC name is 7-[1,8-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-methyl-3H-isoindol-1-one.
| Compound Name | 7-[1,8-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134241711 |
| Molecular Formula | C37H20F12N2O |
| Molecular Weight | 736.56 g/mol |
| Exact Mass | 736.14 |
| IUPAC Name | 7-[1,8-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-methyl-3H-isoindol-1-one |
| SMILES | CN1Cc2cccc(-n3c4c(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cccc4c4cccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)c43)c2C1=O |
| InChI | InChI=1S/C37H20F12N2O/c1-50-17-18-5-2-10-29(30(18)33(50)52)51-31-23(21-13-11-19(34(38,39)40)15-27(21)36(44,45)46)6-3-8-25(31)26-9-4-7-24(32(26)51)22-14-12-20(35(41,42)43)16-28(22)37(47,48)49/h2-16H,17H2,1H3 |
| InChIKey | RYWIXHOLUFXKAZ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.56 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |