C19H21N3O2S — CID 134241823
4-[3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid (PubChem CID 134241823) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid.
| Compound Name | 4-[3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 134241823 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[3-(2,4,6-trimethylphenyl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid |
| SMILES | Cc1cc(C)c(-n2c(SCCCC(=O)O)nc3cccnc32)c(C)c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-12-10-13(2)17(14(3)11-12)22-18-15(6-4-8-20-18)21-19(22)25-9-5-7-16(23)24/h4,6,8,10-11H,5,7,9H2,1-3H3,(H,23,24) |
| InChIKey | CSKCPZSBRQTUOQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|