C18H31N3O — CID 134242040
(3E,4E,7Z)-3-methoxyimino-2-methyl-7-(2-methylpropylideneamino)-5-propan-2-ylnona-1,4,7-trien-4-amine (PubChem CID 134242040) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (3E,4E,7Z)-3-methoxyimino-2-methyl-7-(2-methylpropylideneamino)-5-propan-2-ylnona-1,4,7-trien-4-amine.
| Compound Name | (3E,4E,7Z)-3-methoxyimino-2-methyl-7-(2-methylpropylideneamino)-5-propan-2-ylnona-1,4,7-trien-4-amine |
|---|---|
| PubChem CID | 134242040 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (3E,4E,7Z)-3-methoxyimino-2-methyl-7-(2-methylpropylideneamino)-5-propan-2-ylnona-1,4,7-trien-4-amine |
| SMILES | C=C(C)C(=N\OC)/C(N)=C(/CC(=C/C)/N=C/C(C)C)C(C)C |
| InChI | InChI=1S/C18H31N3O/c1-9-15(20-11-12(2)3)10-16(13(4)5)17(19)18(14(6)7)21-22-8/h9,11-13H,6,10,19H2,1-5,7-8H3/b15-9-,17-16+,20-11+,21-18+ |
| InChIKey | CKMUSWGPFBILEQ-OGJHOXDWSA-N |
| XLogP | 4.45 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|