C9H11F3S — CID 134242094
[(3Z,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-2-yl] thiohypofluorite (PubChem CID 134242094) has the molecular formula C9H11F3S and a molecular weight of 208.25 g/mol. Its IUPAC name is [(3Z,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-2-yl] thiohypofluorite.
| Compound Name | [(3Z,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-2-yl] thiohypofluorite |
|---|---|
| PubChem CID | 134242094 |
| Molecular Formula | C9H11F3S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [(3Z,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-2-yl] thiohypofluorite |
| SMILES | C=C(/C=C\C(=C/C)C(C)(F)F)SF |
| InChI | InChI=1S/C9H11F3S/c1-4-8(9(3,10)11)6-5-7(2)13-12/h4-6H,2H2,1,3H3/b6-5-,8-4+ |
| InChIKey | AAYPJSAECTWXFW-QNMAEOQASA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|