C13H13NO — CID 134242142
(3Z,7Z)-9-hydroxy-2,5,6-trimethylidenedeca-3,7,9-trienenitrile (PubChem CID 134242142) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (3Z,7Z)-9-hydroxy-2,5,6-trimethylidenedeca-3,7,9-trienenitrile.
| Compound Name | (3Z,7Z)-9-hydroxy-2,5,6-trimethylidenedeca-3,7,9-trienenitrile |
|---|---|
| PubChem CID | 134242142 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (3Z,7Z)-9-hydroxy-2,5,6-trimethylidenedeca-3,7,9-trienenitrile |
| SMILES | C=C(O)/C=C\C(=C)C(=C)/C=C\C(=C)C#N |
| InChI | InChI=1S/C13H13NO/c1-10(9-14)5-6-11(2)12(3)7-8-13(4)15/h5-8,15H,1-4H2/b6-5-,8-7- |
| InChIKey | KODCDYXWXQSRGZ-ISTTXYCBSA-N |
| XLogP | 3.36 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|