C18H22N4O — CID 134242529
2-[(3R,5S)-3-(8-methanimidoylquinolin-5-yl)-5-methylpiperidin-1-yl]acetamide (PubChem CID 134242529) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(3R,5S)-3-(8-methanimidoylquinolin-5-yl)-5-methylpiperidin-1-yl]acetamide.
| Compound Name | 2-[(3R,5S)-3-(8-methanimidoylquinolin-5-yl)-5-methylpiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 134242529 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[(3R,5S)-3-(8-methanimidoylquinolin-5-yl)-5-methylpiperidin-1-yl]acetamide |
| SMILES | [H]/N=C/c1ccc([C@H]2C[C@H](C)CN(CC(N)=O)C2)c2cccnc12 |
| InChI | InChI=1S/C18H22N4O/c1-12-7-14(10-22(9-12)11-17(20)23)15-5-4-13(8-19)18-16(15)3-2-6-21-18/h2-6,8,12,14,19H,7,9-11H2,1H3,(H2,20,23)/b19-8+/t12-,14-/m0/s1 |
| InChIKey | GUCLRAFNDKGRPT-FPLHFXQWSA-N |
| XLogP | 2.14 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|