C14H25NO — CID 134242988
N-methyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypentan-1-amine (PubChem CID 134242988) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-methyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypentan-1-amine.
| Compound Name | N-methyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypentan-1-amine |
|---|---|
| PubChem CID | 134242988 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-methyl-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxypentan-1-amine |
| SMILES | C=C(C)/C=C\C(=C/C)OC(CC)CCNC |
| InChI | InChI=1S/C14H25NO/c1-6-13(9-8-12(3)4)16-14(7-2)10-11-15-5/h6,8-9,14-15H,3,7,10-11H2,1-2,4-5H3/b9-8-,13-6+ |
| InChIKey | FULOFYOPHVUHFS-GFBXJKNCSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|