About 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene
5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene (PubChem CID 134242989) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene.
Analyze 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The IUPAC name of 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene (CID 134242989) is 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene.
What is the SMILES notation for 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The canonical SMILES for 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene is CCC(C)C1=CN=CN=C=C1.
What is the InChIKey of 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
The InChIKey is QEQAJPGVOWTNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-8(2)9-4-5-10-7-11-6-9/h4,6-8H,3H2,1-2H3.
What are the key properties of 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene?
5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene has a molecular weight of 148.21 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-1,3-diazacyclohepta-2,4,6,7-tetraene is sourced from PubChem (CID 134242989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).