About (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine
(2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine (PubChem CID 134243565) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine |
| PubChem CID | 134243565 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine |
| SMILES | NCC1=CSC(C2CCCCC2)N1 |
| InChI | InChI=1S/C10H18N2S/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h7-8,10,12H,1-6,11H2 |
| InChIKey | BBNOJRSNPHMWHQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The IUPAC name of (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine (CID 134243565) is (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine.
What is the SMILES notation for (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The canonical SMILES for (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine is NCC1=CSC(C2CCCCC2)N1.
What is the InChIKey of (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
The InChIKey is BBNOJRSNPHMWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h7-8,10,12H,1-6,11H2.
What are the key properties of (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine?
(2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine has a molecular weight of 198.33 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-2,3-dihydro-1,3-thiazol-4-yl)methanamine is sourced from PubChem (CID 134243565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).