C13H28N2O — CID 134244111
3-methyl-3-(6,6,7-trimethyl-1,4-diazepan-1-yl)butan-1-ol (PubChem CID 134244111) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-methyl-3-(6,6,7-trimethyl-1,4-diazepan-1-yl)butan-1-ol.
| Compound Name | 3-methyl-3-(6,6,7-trimethyl-1,4-diazepan-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 134244111 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 3-methyl-3-(6,6,7-trimethyl-1,4-diazepan-1-yl)butan-1-ol |
| SMILES | CC1N(C(C)(C)CCO)CCNCC1(C)C |
| InChI | InChI=1S/C13H28N2O/c1-11-12(2,3)10-14-7-8-15(11)13(4,5)6-9-16/h11,14,16H,6-10H2,1-5H3 |
| InChIKey | WCGSIWXTSGTUTQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |