About 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene
2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene (PubChem CID 134244113) has the molecular formula C18H20S3
and a molecular weight of 332.56 g/mol. Its IUPAC name is 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene.
Molecular Properties
| Compound Name | 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene |
| PubChem CID | 134244113 |
| Molecular Formula | C18H20S3 |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene |
| SMILES | Cc1cc(-c2cc(Cc3scc(C)c3C)c(C)s2)sc1C |
| InChI | InChI=1S/C18H20S3/c1-10-6-17(20-13(10)4)18-8-15(14(5)21-18)7-16-12(3)11(2)9-19-16/h6,8-9H,7H2,1-5H3 |
| InChIKey | IQBHVOSSAJGRBN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene?
The IUPAC name of 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene (CID 134244113) is 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene.
What is the SMILES notation for 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene?
The canonical SMILES for 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene is Cc1cc(-c2cc(Cc3scc(C)c3C)c(C)s2)sc1C.
What is the InChIKey of 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene?
The InChIKey is IQBHVOSSAJGRBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20S3/c1-10-6-17(20-13(10)4)18-8-15(14(5)21-18)7-16-12(3)11(2)9-19-16/h6,8-9H,7H2,1-5H3.
What are the key properties of 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene?
2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene has a molecular weight of 332.56 g/mol, XLogP of 6.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(4,5-dimethylthiophen-2-yl)-2-methylthiophen-3-yl]methyl]-3,4-dimethylthiophene is sourced from PubChem (CID 134244113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).