C31H53NO — CID 134245031
N-[(3R,5R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylprop-2-enamide (PubChem CID 134245031) has the molecular formula C31H53NO and a molecular weight of 455.77 g/mol. Its IUPAC name is N-[(3R,5R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylprop-2-enamide.
| Compound Name | N-[(3R,5R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 134245031 |
| Molecular Formula | C31H53NO |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.41 |
| IUPAC Name | N-[(3R,5R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)[C@@H]1CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4[C@H](C)CCCC(C)C)C3CC[C@@H]2C1 |
| InChI | InChI=1S/C31H53NO/c1-8-29(33)32(7)24-16-18-30(5)23(20-24)12-13-25-27-15-14-26(22(4)11-9-10-21(2)3)31(27,6)19-17-28(25)30/h8,21-28H,1,9-20H2,2-7H3/t22-,23-,24-,25?,26-,27?,28?,30+,31-/m1/s1 |
| InChIKey | OBNZDPGHFPUWEK-WBLWVLNDSA-N |
| XLogP | 8.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|