About ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate
ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate (PubChem CID 134247426) has the molecular formula C24H30F3NO4S
and a molecular weight of 485.57 g/mol. Its IUPAC name is ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate |
| PubChem CID | 134247426 |
| Molecular Formula | C24H30F3NO4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate |
| SMILES | CCOC(=O)CCCCCCc1cccc(S(=O)(=O)Nc2c(C)cc(C(F)(F)F)cc2C)c1 |
| InChI | InChI=1S/C24H30F3NO4S/c1-4-32-22(29)13-8-6-5-7-10-19-11-9-12-21(16-19)33(30,31)28-23-17(2)14-20(15-18(23)3)24(25,26)27/h9,11-12,14-16,28H,4-8,10,13H2,1-3H3 |
| InChIKey | IYNGWKJBBIVOBQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate?
The IUPAC name of ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate (CID 134247426) is ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate.
What is the SMILES notation for ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate?
The canonical SMILES for ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate is CCOC(=O)CCCCCCc1cccc(S(=O)(=O)Nc2c(C)cc(C(F)(F)F)cc2C)c1.
What is the InChIKey of ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate?
The InChIKey is IYNGWKJBBIVOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30F3NO4S/c1-4-32-22(29)13-8-6-5-7-10-19-11-9-12-21(16-19)33(30,31)28-23-17(2)14-20(15-18(23)3)24(25,26)27/h9,11-12,14-16,28H,4-8,10,13H2,1-3H3.
What are the key properties of ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate?
ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate has a molecular weight of 485.57 g/mol, XLogP of 6.18, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[3-[[2,6-dimethyl-4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]heptanoate is sourced from PubChem (CID 134247426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).