About methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate
methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate (PubChem CID 134247434) has the molecular formula C22H28FNO4S
and a molecular weight of 421.53 g/mol. Its IUPAC name is methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate |
| PubChem CID | 134247434 |
| Molecular Formula | C22H28FNO4S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate |
| SMILES | COC(=O)CCCCCCc1ccc(S(=O)(=O)Nc2c(C)cc(F)cc2C)cc1 |
| InChI | InChI=1S/C22H28FNO4S/c1-16-14-19(23)15-17(2)22(16)24-29(26,27)20-12-10-18(11-13-20)8-6-4-5-7-9-21(25)28-3/h10-15,24H,4-9H2,1-3H3 |
| InChIKey | QMMSIEXHVFRLQG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate?
The IUPAC name of methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate (CID 134247434) is methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate.
What is the SMILES notation for methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate?
The canonical SMILES for methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate is COC(=O)CCCCCCc1ccc(S(=O)(=O)Nc2c(C)cc(F)cc2C)cc1.
What is the InChIKey of methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate?
The InChIKey is QMMSIEXHVFRLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28FNO4S/c1-16-14-19(23)15-17(2)22(16)24-29(26,27)20-12-10-18(11-13-20)8-6-4-5-7-9-21(25)28-3/h10-15,24H,4-9H2,1-3H3.
What are the key properties of methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate?
methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate has a molecular weight of 421.53 g/mol, XLogP of 4.91, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[4-[(4-fluoro-2,6-dimethylphenyl)sulfamoyl]phenyl]heptanoate is sourced from PubChem (CID 134247434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).